About 2-[2-[1,1-difluoropropoxy(difluoro)methoxy]-2,2-difluoroethoxy]ethyl trifluoromethanesulfonate
2-[2-[1,1-difluoropropoxy(difluoro)methoxy]-2,2-difluoroethoxy]ethyl trifluoromethanesulfonate (PubChem CID 164992454) has the molecular formula C9H11F9O6S
and a molecular weight of 418.23 g/mol. Its IUPAC name is 2-[2-[1,1-difluoropropoxy(difluoro)methoxy]-2,2-difluoroethoxy]ethyl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 2-[2-[1,1-difluoropropoxy(difluoro)methoxy]-2,2-difluoroethoxy]ethyl trifluoromethanesulfonate |
| PubChem CID | 164992454 |
| Molecular Formula | C9H11F9O6S |
| Molecular Weight | 418.23 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | 2-[2-[1,1-difluoropropoxy(difluoro)methoxy]-2,2-difluoroethoxy]ethyl trifluoromethanesulfonate |
| SMILES | CCC(F)(F)OC(F)(F)OC(F)(F)COCCOS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H11F9O6S/c1-2-6(10,11)23-9(17,18)24-7(12,13)5-21-3-4-22-25(19,20)8(14,15)16/h2-5H2,1H3 |
| InChIKey | HAZSZKQAROBUBG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.23 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[1,1-difluoropropoxy(difluoro)methoxy]-2,2-difluoroethoxy]ethyl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[1,1-difluoropropoxy(difluoro)methoxy]-2,2-difluoroethoxy]ethyl trifluoromethanesulfonate?
The IUPAC name of 2-[2-[1,1-difluoropropoxy(difluoro)methoxy]-2,2-difluoroethoxy]ethyl trifluoromethanesulfonate (CID 164992454) is 2-[2-[1,1-difluoropropoxy(difluoro)methoxy]-2,2-difluoroethoxy]ethyl trifluoromethanesulfonate.
What is the SMILES notation for 2-[2-[1,1-difluoropropoxy(difluoro)methoxy]-2,2-difluoroethoxy]ethyl trifluoromethanesulfonate?
The canonical SMILES for 2-[2-[1,1-difluoropropoxy(difluoro)methoxy]-2,2-difluoroethoxy]ethyl trifluoromethanesulfonate is CCC(F)(F)OC(F)(F)OC(F)(F)COCCOS(=O)(=O)C(F)(F)F.
What is the InChIKey of 2-[2-[1,1-difluoropropoxy(difluoro)methoxy]-2,2-difluoroethoxy]ethyl trifluoromethanesulfonate?
The InChIKey is HAZSZKQAROBUBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F9O6S/c1-2-6(10,11)23-9(17,18)24-7(12,13)5-21-3-4-22-25(19,20)8(14,15)16/h2-5H2,1H3.
What are the key properties of 2-[2-[1,1-difluoropropoxy(difluoro)methoxy]-2,2-difluoroethoxy]ethyl trifluoromethanesulfonate?
2-[2-[1,1-difluoropropoxy(difluoro)methoxy]-2,2-difluoroethoxy]ethyl trifluoromethanesulfonate has a molecular weight of 418.23 g/mol, XLogP of 3.05, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[1,1-difluoropropoxy(difluoro)methoxy]-2,2-difluoroethoxy]ethyl trifluoromethanesulfonate is sourced from PubChem (CID 164992454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).