C14H14F3N3O6S2 — CID 164992753
3-[2-[4-(1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]ethylsulfonyl]propanoic acid;2,2,2-trifluoroacetate (PubChem CID 164992753) has the molecular formula C14H14F3N3O6S2 and a molecular weight of 441.41 g/mol. Its IUPAC name is 3-[2-[4-(1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]ethylsulfonyl]propanoic acid;2,2,2-trifluoroacetate.
| Compound Name | 3-[2-[4-(1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]ethylsulfonyl]propanoic acid;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 164992753 |
| Molecular Formula | C14H14F3N3O6S2 |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | 3-[2-[4-(1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]ethylsulfonyl]propanoic acid;2,2,2-trifluoroacetate |
| SMILES | O=C(O)CCS(=O)(=O)CC[n+]1ccc(-c2nccs2)cn1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C12H13N3O4S2.C2HF3O2/c16-11(17)2-7-21(18,19)8-5-15-4-1-10(9-14-15)12-13-3-6-20-12;3-2(4,5)1(6)7/h1,3-4,6,9H,2,5,7-8H2;(H,6,7) |
| InChIKey | NPHFEQJOWRSHQF-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 141.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|