C32H25Cl5N4 — CID 164993025
1-[(2-chlorophenyl)-diphenylmethyl]imidazole;1-chloro-2-(trichloromethyl)benzene;1H-imidazole (PubChem CID 164993025) has the molecular formula C32H25Cl5N4 and a molecular weight of 642.85 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)-diphenylmethyl]imidazole;1-chloro-2-(trichloromethyl)benzene;1H-imidazole.
| Compound Name | 1-[(2-chlorophenyl)-diphenylmethyl]imidazole;1-chloro-2-(trichloromethyl)benzene;1H-imidazole |
|---|---|
| PubChem CID | 164993025 |
| Molecular Formula | C32H25Cl5N4 |
| Molecular Weight | 642.85 g/mol |
| Exact Mass | 640.05 |
| IUPAC Name | 1-[(2-chlorophenyl)-diphenylmethyl]imidazole;1-chloro-2-(trichloromethyl)benzene;1H-imidazole |
| SMILES | Clc1ccccc1C(Cl)(Cl)Cl.Clc1ccccc1C(c1ccccc1)(c1ccccc1)n1ccnc1.c1c[nH]cn1 |
| InChI | InChI=1S/C22H17ClN2.C7H4Cl4.C3H4N2/c23-21-14-8-7-13-20(21)22(25-16-15-24-17-25,18-9-3-1-4-10-18)19-11-5-2-6-12-19;8-6-4-2-1-3-5(6)7(9,10)11;1-2-5-3-4-1/h1-17H;1-4H;1-3H,(H,4,5) |
| InChIKey | HDFKXIKUDHYFFG-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.85 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|