C31H14F4O4S2 — CID 164993377
(3Z)-3-[[10-[(Z)-(4,6-difluoro-2,3-dioxoinden-1-ylidene)methyl]-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]methylidene]-5,7-difluoroindene-1,2-dione (PubChem CID 164993377) has the molecular formula C31H14F4O4S2 and a molecular weight of 590.58 g/mol. Its IUPAC name is (3Z)-3-[[10-[(Z)-(4,6-difluoro-2,3-dioxoinden-1-ylidene)methyl]-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]methylidene]-5,7-difluoroindene-1,2-dione.
| Compound Name | (3Z)-3-[[10-[(Z)-(4,6-difluoro-2,3-dioxoinden-1-ylidene)methyl]-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]methylidene]-5,7-difluoroindene-1,2-dione |
|---|---|
| PubChem CID | 164993377 |
| Molecular Formula | C31H14F4O4S2 |
| Molecular Weight | 590.58 g/mol |
| Exact Mass | 590.03 |
| IUPAC Name | (3Z)-3-[[10-[(Z)-(4,6-difluoro-2,3-dioxoinden-1-ylidene)methyl]-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]methylidene]-5,7-difluoroindene-1,2-dione |
| SMILES | CC1(C)c2cc(/C=C3\C(=O)C(=O)c4c(F)cc(F)cc43)sc2-c2sc(/C=C3\C(=O)C(=O)c4c(F)cc(F)cc43)cc21 |
| InChI | InChI=1S/C31H14F4O4S2/c1-31(2)19-9-13(7-17-15-3-11(32)5-21(34)23(15)27(38)25(17)36)40-29(19)30-20(31)10-14(41-30)8-18-16-4-12(33)6-22(35)24(16)28(39)26(18)37/h3-10H,1-2H3/b17-7-,18-8- |
| InChIKey | LMEIULFCXWBAPD-MZAUSLISSA-N |
| XLogP | 7.28 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.58 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|