C5H13NS2 — CID 164996291
2,2-dideuterio-2-(1,1,2-trideuteriopropyldisulfanyl)ethanamine (PubChem CID 164996291) has the molecular formula C5H13NS2 and a molecular weight of 156.33 g/mol. Its IUPAC name is 2,2-dideuterio-2-(1,1,2-trideuteriopropyldisulfanyl)ethanamine.
| Compound Name | 2,2-dideuterio-2-(1,1,2-trideuteriopropyldisulfanyl)ethanamine |
|---|---|
| PubChem CID | 164996291 |
| Molecular Formula | C5H13NS2 |
| Molecular Weight | 156.33 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 2,2-dideuterio-2-(1,1,2-trideuteriopropyldisulfanyl)ethanamine |
| SMILES | [2H]C(C)C([2H])([2H])SSC([2H])([2H])CN |
| InChI | InChI=1S/C5H13NS2/c1-2-4-7-8-5-3-6/h2-6H2,1H3/i2D,4D2,5D2 |
| InChIKey | RRHTVPZYUQSUFT-UUVPGLJISA-N |
| XLogP | 1.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|