C31H38F6N4 — CID 164996477
(6E)-2-[7-[[(3Z)-2-cyano-5,5-dimethyl-3-(1,1,1-trifluoropropan-2-ylidene)cyclohexen-1-yl]amino]heptyl]-6-(1-cyano-2,2,2-trifluoroethylidene)-4,4-dimethylcyclohexene-1-carbonitrile (PubChem CID 164996477) has the molecular formula C31H38F6N4 and a molecular weight of 580.66 g/mol. Its IUPAC name is (6E)-2-[7-[[(3Z)-2-cyano-5,5-dimethyl-3-(1,1,1-trifluoropropan-2-ylidene)cyclohexen-1-yl]amino]heptyl]-6-(1-cyano-2,2,2-trifluoroethylidene)-4,4-dimethylcyclohexene-1-carbonitrile.
| Compound Name | (6E)-2-[7-[[(3Z)-2-cyano-5,5-dimethyl-3-(1,1,1-trifluoropropan-2-ylidene)cyclohexen-1-yl]amino]heptyl]-6-(1-cyano-2,2,2-trifluoroethylidene)-4,4-dimethylcyclohexene-1-carbonitrile |
|---|---|
| PubChem CID | 164996477 |
| Molecular Formula | C31H38F6N4 |
| Molecular Weight | 580.66 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | (6E)-2-[7-[[(3Z)-2-cyano-5,5-dimethyl-3-(1,1,1-trifluoropropan-2-ylidene)cyclohexen-1-yl]amino]heptyl]-6-(1-cyano-2,2,2-trifluoroethylidene)-4,4-dimethylcyclohexene-1-carbonitrile |
| SMILES | C/C(=C1\CC(C)(C)CC(NCCCCCCCC2=C(C#N)/C(=C(\C#N)C(F)(F)F)CC(C)(C)C2)=C1C#N)C(F)(F)F |
| InChI | InChI=1S/C31H38F6N4/c1-20(30(32,33)34)22-14-29(4,5)16-27(25(22)18-39)41-12-10-8-6-7-9-11-21-13-28(2,3)15-23(24(21)17-38)26(19-40)31(35,36)37/h41H,6-16H2,1-5H3/b22-20-,26-23+ |
| InChIKey | WKMRLCNTNQJGDF-KRWISNKQSA-N |
| XLogP | 9.42 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.66 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|