C31H41F6N3 — CID 164996478
2-[7-[[(3Z)-2-cyano-3-(1,1-difluoropropan-2-ylidene)-5,5-dimethylcyclohexen-1-yl]amino]heptyl]-4,4-dimethyl-6-(1,1,3,3-tetrafluoropropan-2-ylidene)cyclohexene-1-carbonitrile (PubChem CID 164996478) has the molecular formula C31H41F6N3 and a molecular weight of 569.68 g/mol. Its IUPAC name is 2-[7-[[(3Z)-2-cyano-3-(1,1-difluoropropan-2-ylidene)-5,5-dimethylcyclohexen-1-yl]amino]heptyl]-4,4-dimethyl-6-(1,1,3,3-tetrafluoropropan-2-ylidene)cyclohexene-1-carbonitrile.
| Compound Name | 2-[7-[[(3Z)-2-cyano-3-(1,1-difluoropropan-2-ylidene)-5,5-dimethylcyclohexen-1-yl]amino]heptyl]-4,4-dimethyl-6-(1,1,3,3-tetrafluoropropan-2-ylidene)cyclohexene-1-carbonitrile |
|---|---|
| PubChem CID | 164996478 |
| Molecular Formula | C31H41F6N3 |
| Molecular Weight | 569.68 g/mol |
| Exact Mass | 569.32 |
| IUPAC Name | 2-[7-[[(3Z)-2-cyano-3-(1,1-difluoropropan-2-ylidene)-5,5-dimethylcyclohexen-1-yl]amino]heptyl]-4,4-dimethyl-6-(1,1,3,3-tetrafluoropropan-2-ylidene)cyclohexene-1-carbonitrile |
| SMILES | C/C(=C1\CC(C)(C)CC(NCCCCCCCC2=C(C#N)C(=C(C(F)F)C(F)F)CC(C)(C)C2)=C1C#N)C(F)F |
| InChI | InChI=1S/C31H41F6N3/c1-19(27(32)33)21-14-31(4,5)16-25(24(21)18-39)40-12-10-8-6-7-9-11-20-13-30(2,3)15-22(23(20)17-38)26(28(34)35)29(36)37/h27-29,40H,6-16H2,1-5H3/b21-19- |
| InChIKey | LDZBSJSJXULXOY-VZCXRCSSSA-N |
| XLogP | 9.56 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.68 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|