C23H24F3N7S — CID 164998842
molecular hydrogen;N-[4-(1H-1,2,4-triazol-5-yl)phenyl]-6-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-6-azaspiro[3.4]octan-2-amine (PubChem CID 164998842) has the molecular formula C23H24F3N7S and a molecular weight of 487.56 g/mol. Its IUPAC name is molecular hydrogen;N-[4-(1H-1,2,4-triazol-5-yl)phenyl]-6-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-6-azaspiro[3.4]octan-2-amine.
| Compound Name | molecular hydrogen;N-[4-(1H-1,2,4-triazol-5-yl)phenyl]-6-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-6-azaspiro[3.4]octan-2-amine |
|---|---|
| PubChem CID | 164998842 |
| Molecular Formula | C23H24F3N7S |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | molecular hydrogen;N-[4-(1H-1,2,4-triazol-5-yl)phenyl]-6-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-6-azaspiro[3.4]octan-2-amine |
| SMILES | FC(F)(F)Cc1cc2c(N3CCC4(CC(Nc5ccc(-c6ncn[nH]6)cc5)C4)C3)ncnc2s1.[H][H] |
| InChI | InChI=1S/C23H22F3N7S.H2/c24-23(25,26)10-17-7-18-20(28-12-29-21(18)34-17)33-6-5-22(11-33)8-16(9-22)31-15-3-1-14(2-4-15)19-27-13-30-32-19;/h1-4,7,12-13,16,31H,5-6,8-11H2,(H,27,30,32);1H |
| InChIKey | HYBMJEGCDXYBNF-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |