C37H24F3NO4S — CID 164999945
[3-[2-(4-dibenzofuran-3-yl-6-phenyl-3-pyridinyl)phenyl]-5-methylphenyl] trifluoromethanesulfonate (PubChem CID 164999945) has the molecular formula C37H24F3NO4S and a molecular weight of 635.66 g/mol. Its IUPAC name is [3-[2-(4-dibenzofuran-3-yl-6-phenyl-3-pyridinyl)phenyl]-5-methylphenyl] trifluoromethanesulfonate.
| Compound Name | [3-[2-(4-dibenzofuran-3-yl-6-phenyl-3-pyridinyl)phenyl]-5-methylphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 164999945 |
| Molecular Formula | C37H24F3NO4S |
| Molecular Weight | 635.66 g/mol |
| Exact Mass | 635.14 |
| IUPAC Name | [3-[2-(4-dibenzofuran-3-yl-6-phenyl-3-pyridinyl)phenyl]-5-methylphenyl] trifluoromethanesulfonate |
| SMILES | Cc1cc(OS(=O)(=O)C(F)(F)F)cc(-c2ccccc2-c2cnc(-c3ccccc3)cc2-c2ccc3c(c2)oc2ccccc23)c1 |
| InChI | InChI=1S/C37H24F3NO4S/c1-23-17-26(19-27(18-23)45-46(42,43)37(38,39)40)28-11-5-6-12-29(28)33-22-41-34(24-9-3-2-4-10-24)21-32(33)25-15-16-31-30-13-7-8-14-35(30)44-36(31)20-25/h2-22H,1H3 |
| InChIKey | ICLHHRNZLASEJK-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.66 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|