C19H19BBrFIN3O2 — CID 165000051
4-[(5-bromo-1-ethylpyrazol-4-yl)methyl]-3-iodopyridine;5-fluoro-1-hydroxy-3-methyl-3H-2,1-benzoxaborole (PubChem CID 165000051) has the molecular formula C19H19BBrFIN3O2 and a molecular weight of 558.00 g/mol. Its IUPAC name is 4-[(5-bromo-1-ethylpyrazol-4-yl)methyl]-3-iodopyridine;5-fluoro-1-hydroxy-3-methyl-3H-2,1-benzoxaborole.
| Compound Name | 4-[(5-bromo-1-ethylpyrazol-4-yl)methyl]-3-iodopyridine;5-fluoro-1-hydroxy-3-methyl-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 165000051 |
| Molecular Formula | C19H19BBrFIN3O2 |
| Molecular Weight | 558.00 g/mol |
| Exact Mass | 556.98 |
| IUPAC Name | 4-[(5-bromo-1-ethylpyrazol-4-yl)methyl]-3-iodopyridine;5-fluoro-1-hydroxy-3-methyl-3H-2,1-benzoxaborole |
| SMILES | CC1OB(O)c2ccc(F)cc21.CCn1ncc(Cc2ccncc2I)c1Br |
| InChI | InChI=1S/C11H11BrIN3.C8H8BFO2/c1-2-16-11(12)9(6-15-16)5-8-3-4-14-7-10(8)13;1-5-7-4-6(10)2-3-8(7)9(11)12-5/h3-4,6-7H,2,5H2,1H3;2-5,11H,1H3 |
| InChIKey | ICWBAXTUISEQQG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.00 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|