C23H26N2O2 — CID 165000505
5-methyl-3-[(7-methyl-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)methyl]-2-propan-2-ylbenzene-1,4-diol (PubChem CID 165000505) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 5-methyl-3-[(7-methyl-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)methyl]-2-propan-2-ylbenzene-1,4-diol.
| Compound Name | 5-methyl-3-[(7-methyl-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)methyl]-2-propan-2-ylbenzene-1,4-diol |
|---|---|
| PubChem CID | 165000505 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 5-methyl-3-[(7-methyl-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)methyl]-2-propan-2-ylbenzene-1,4-diol |
| SMILES | Cc1ccc2c3c([nH]c2c1)C(Cc1c(O)c(C)cc(O)c1C(C)C)=NCC3 |
| InChI | InChI=1S/C23H26N2O2/c1-12(2)21-17(23(27)14(4)10-20(21)26)11-19-22-16(7-8-24-19)15-6-5-13(3)9-18(15)25-22/h5-6,9-10,12,25-27H,7-8,11H2,1-4H3 |
| InChIKey | VNSAMHHELYYKEA-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 68.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|