C18H26FNO5 — CID 165000992
N-[(2S,5S)-4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]-5-(4-fluorophenyl)pentanamide (PubChem CID 165000992) has the molecular formula C18H26FNO5 and a molecular weight of 355.41 g/mol. Its IUPAC name is N-[(2S,5S)-4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]-5-(4-fluorophenyl)pentanamide.
| Compound Name | N-[(2S,5S)-4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]-5-(4-fluorophenyl)pentanamide |
|---|---|
| PubChem CID | 165000992 |
| Molecular Formula | C18H26FNO5 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | N-[(2S,5S)-4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]-5-(4-fluorophenyl)pentanamide |
| SMILES | C[C@@H]1OC(CO)[C@@H](O)C(O)C1NC(=O)CCCCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H26FNO5/c1-11-16(18(24)17(23)14(10-21)25-11)20-15(22)5-3-2-4-12-6-8-13(19)9-7-12/h6-9,11,14,16-18,21,23-24H,2-5,10H2,1H3,(H,20,22)/t11-,14?,16?,17+,18?/m0/s1 |
| InChIKey | IGEQGUDRMTZVSE-CORRRBRISA-N |
| XLogP | 0.52 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|