C22H15Cl2N3O2S — CID 16500260
N-(2-chlorophenyl)-2-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide (PubChem CID 16500260) has the molecular formula C22H15Cl2N3O2S and a molecular weight of 456.35 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-(2-chlorophenyl)-2-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 16500260 |
| Molecular Formula | C22H15Cl2N3O2S |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 455.03 |
| IUPAC Name | N-(2-chlorophenyl)-2-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1-c1cccc(Cl)c1)Nc1ccccc1Cl |
| InChI | InChI=1S/C22H15Cl2N3O2S/c23-14-6-5-7-15(12-14)27-21(29)16-8-1-3-10-18(16)26-22(27)30-13-20(28)25-19-11-4-2-9-17(19)24/h1-12H,13H2,(H,25,28) |
| InChIKey | ZIGLMRHBGALXRC-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |