About 4-chloro-1-(3-methoxy-3-methylbutyl)pyrido[3,4-d]pyridazine
4-chloro-1-(3-methoxy-3-methylbutyl)pyrido[3,4-d]pyridazine (PubChem CID 165003688) has the molecular formula C13H16ClN3O
and a molecular weight of 265.74 g/mol. Its IUPAC name is 4-chloro-1-(3-methoxy-3-methylbutyl)pyrido[3,4-d]pyridazine.
Molecular Properties
| Compound Name | 4-chloro-1-(3-methoxy-3-methylbutyl)pyrido[3,4-d]pyridazine |
| PubChem CID | 165003688 |
| Molecular Formula | C13H16ClN3O |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 4-chloro-1-(3-methoxy-3-methylbutyl)pyrido[3,4-d]pyridazine |
| SMILES | COC(C)(C)CCc1nnc(Cl)c2cnccc12 |
| InChI | InChI=1S/C13H16ClN3O/c1-13(2,18-3)6-4-11-9-5-7-15-8-10(9)12(14)17-16-11/h5,7-8H,4,6H2,1-3H3 |
| InChIKey | DJRNRCDBZKPAQU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-1-(3-methoxy-3-methylbutyl)pyrido[3,4-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1-(3-methoxy-3-methylbutyl)pyrido[3,4-d]pyridazine?
The IUPAC name of 4-chloro-1-(3-methoxy-3-methylbutyl)pyrido[3,4-d]pyridazine (CID 165003688) is 4-chloro-1-(3-methoxy-3-methylbutyl)pyrido[3,4-d]pyridazine.
What is the SMILES notation for 4-chloro-1-(3-methoxy-3-methylbutyl)pyrido[3,4-d]pyridazine?
The canonical SMILES for 4-chloro-1-(3-methoxy-3-methylbutyl)pyrido[3,4-d]pyridazine is COC(C)(C)CCc1nnc(Cl)c2cnccc12.
What is the InChIKey of 4-chloro-1-(3-methoxy-3-methylbutyl)pyrido[3,4-d]pyridazine?
The InChIKey is DJRNRCDBZKPAQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClN3O/c1-13(2,18-3)6-4-11-9-5-7-15-8-10(9)12(14)17-16-11/h5,7-8H,4,6H2,1-3H3.
What are the key properties of 4-chloro-1-(3-methoxy-3-methylbutyl)pyrido[3,4-d]pyridazine?
4-chloro-1-(3-methoxy-3-methylbutyl)pyrido[3,4-d]pyridazine has a molecular weight of 265.74 g/mol, XLogP of 3.04, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1-(3-methoxy-3-methylbutyl)pyrido[3,4-d]pyridazine is sourced from PubChem (CID 165003688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).