C26H39N3O3 — CID 165004516
(2S)-6-[ethyl-[(1R)-1-(5-methoxy-2-pyridinyl)ethyl]amino]-N-hydroxy-2-[(3,4,5-trimethylphenyl)methyl]hexanamide (PubChem CID 165004516) has the molecular formula C26H39N3O3 and a molecular weight of 441.62 g/mol. Its IUPAC name is (2S)-6-[ethyl-[(1R)-1-(5-methoxy-2-pyridinyl)ethyl]amino]-N-hydroxy-2-[(3,4,5-trimethylphenyl)methyl]hexanamide.
| Compound Name | (2S)-6-[ethyl-[(1R)-1-(5-methoxy-2-pyridinyl)ethyl]amino]-N-hydroxy-2-[(3,4,5-trimethylphenyl)methyl]hexanamide |
|---|---|
| PubChem CID | 165004516 |
| Molecular Formula | C26H39N3O3 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.30 |
| IUPAC Name | (2S)-6-[ethyl-[(1R)-1-(5-methoxy-2-pyridinyl)ethyl]amino]-N-hydroxy-2-[(3,4,5-trimethylphenyl)methyl]hexanamide |
| SMILES | CCN(CCCC[C@@H](Cc1cc(C)c(C)c(C)c1)C(=O)NO)[C@H](C)c1ccc(OC)cn1 |
| InChI | InChI=1S/C26H39N3O3/c1-7-29(21(5)25-12-11-24(32-6)17-27-25)13-9-8-10-23(26(30)28-31)16-22-14-18(2)20(4)19(3)15-22/h11-12,14-15,17,21,23,31H,7-10,13,16H2,1-6H3,(H,28,30)/t21-,23+/m1/s1 |
| InChIKey | ZBBIMAFIBSOEQR-GGAORHGYSA-N |
| XLogP | 4.93 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|