C32H58O4 — CID 165004692
ethyl (4R)-4-[(5R,6S,13S,14R,15R)-14-ethyl-15-hydroxy-13-[(4R)-4-hydroxyoctyl]-5-tricyclo[9.4.0.02,6]pentadecanyl]pentanoate (PubChem CID 165004692) has the molecular formula C32H58O4 and a molecular weight of 506.81 g/mol. Its IUPAC name is ethyl (4R)-4-[(5R,6S,13S,14R,15R)-14-ethyl-15-hydroxy-13-[(4R)-4-hydroxyoctyl]-5-tricyclo[9.4.0.02,6]pentadecanyl]pentanoate.
| Compound Name | ethyl (4R)-4-[(5R,6S,13S,14R,15R)-14-ethyl-15-hydroxy-13-[(4R)-4-hydroxyoctyl]-5-tricyclo[9.4.0.02,6]pentadecanyl]pentanoate |
|---|---|
| PubChem CID | 165004692 |
| Molecular Formula | C32H58O4 |
| Molecular Weight | 506.81 g/mol |
| Exact Mass | 506.43 |
| IUPAC Name | ethyl (4R)-4-[(5R,6S,13S,14R,15R)-14-ethyl-15-hydroxy-13-[(4R)-4-hydroxyoctyl]-5-tricyclo[9.4.0.02,6]pentadecanyl]pentanoate |
| SMILES | CCCC[C@@H](O)CCC[C@H]1CC2CCCC[C@@H]3C(CC[C@@H]3[C@H](C)CCC(=O)OCC)C2C(O)[C@@H]1CC |
| InChI | InChI=1S/C32H58O4/c1-5-8-14-25(33)15-11-13-23-21-24-12-9-10-16-28-27(22(4)17-20-30(34)36-7-3)18-19-29(28)31(24)32(35)26(23)6-2/h22-29,31-33,35H,5-21H2,1-4H3/t22-,23+,24?,25-,26-,27-,28+,29?,31?,32?/m1/s1 |
| InChIKey | ITYSIMQOOKKRIQ-XKUYMOELSA-N |
| XLogP | 7.54 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.81 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |