C21H21N3O3 — CID 165005021
(6S)-6-(3-methoxy-5-methylphenyl)-3-(2-nitrophenyl)-4,5,6,7-tetrahydro-1H-indazole (PubChem CID 165005021) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is (6S)-6-(3-methoxy-5-methylphenyl)-3-(2-nitrophenyl)-4,5,6,7-tetrahydro-1H-indazole.
| Compound Name | (6S)-6-(3-methoxy-5-methylphenyl)-3-(2-nitrophenyl)-4,5,6,7-tetrahydro-1H-indazole |
|---|---|
| PubChem CID | 165005021 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | (6S)-6-(3-methoxy-5-methylphenyl)-3-(2-nitrophenyl)-4,5,6,7-tetrahydro-1H-indazole |
| SMILES | COc1cc(C)cc([C@H]2CCc3c(-c4ccccc4[N+](=O)[O-])n[nH]c3C2)c1 |
| InChI | InChI=1S/C21H21N3O3/c1-13-9-15(11-16(10-13)27-2)14-7-8-17-19(12-14)22-23-21(17)18-5-3-4-6-20(18)24(25)26/h3-6,9-11,14H,7-8,12H2,1-2H3,(H,22,23)/t14-/m0/s1 |
| InChIKey | LUXBHQKJNOGHIL-AWEZNQCLSA-N |
| XLogP | 4.57 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|