C52H32O — CID 165005404
2-(2,3,4,5,6-pentadeuteriophenyl)-8-[10-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]phenanthren-3-yl]dibenzofuran (PubChem CID 165005404) has the molecular formula C52H32O and a molecular weight of 682.89 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentadeuteriophenyl)-8-[10-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]phenanthren-3-yl]dibenzofuran.
| Compound Name | 2-(2,3,4,5,6-pentadeuteriophenyl)-8-[10-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]phenanthren-3-yl]dibenzofuran |
|---|---|
| PubChem CID | 165005404 |
| Molecular Formula | C52H32O |
| Molecular Weight | 682.89 g/mol |
| Exact Mass | 682.31 |
| IUPAC Name | 2-(2,3,4,5,6-pentadeuteriophenyl)-8-[10-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]phenanthren-3-yl]dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3oc4ccc(-c5ccc6c(-c7c8ccccc8c(-c8c([2H])c([2H])c([2H])c([2H])c8[2H])c8ccccc78)cc7ccccc7c6c5)cc4c3c2)c([2H])c1[2H] |
| InChI | InChI=1S/C52H32O/c1-3-13-33(14-4-1)35-24-27-49-46(30-35)47-31-37(25-28-50(47)53-49)36-23-26-40-45(29-36)39-18-8-7-17-38(39)32-48(40)52-43-21-11-9-19-41(43)51(34-15-5-2-6-16-34)42-20-10-12-22-44(42)52/h1-32H/i1D,2D,3D,4D,5D,6D,13D,14D,15D,16D |
| InChIKey | LHVWGDMIMTZBFV-QKKUOBQKSA-N |
| XLogP | 14.87 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.89 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|