C23H15Cl2N3O5 — CID 16500610
[1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 4-(1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 16500610) has the molecular formula C23H15Cl2N3O5 and a molecular weight of 484.30 g/mol. Its IUPAC name is [1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 4-(1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 4-(1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 16500610 |
| Molecular Formula | C23H15Cl2N3O5 |
| Molecular Weight | 484.30 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | [1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 4-(1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | CC(OC(=O)c1ccc(N2C(=O)c3ccccc3C2=O)cc1)C(=O)Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C23H15Cl2N3O5/c1-12(20(29)27-19-18(25)10-14(24)11-26-19)33-23(32)13-6-8-15(9-7-13)28-21(30)16-4-2-3-5-17(16)22(28)31/h2-12H,1H3,(H,26,27,29) |
| InChIKey | ZQOREBJXWLOADI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.30 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|