C29H35FN4 — CID 165006297
1-[6-[(1S,3R)-2-(1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]-3-pyridinyl]-N-(3-fluoropropyl)azetidin-3-amine (PubChem CID 165006297) has the molecular formula C29H35FN4 and a molecular weight of 458.63 g/mol. Its IUPAC name is 1-[6-[(1S,3R)-2-(1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]-3-pyridinyl]-N-(3-fluoropropyl)azetidin-3-amine.
| Compound Name | 1-[6-[(1S,3R)-2-(1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]-3-pyridinyl]-N-(3-fluoropropyl)azetidin-3-amine |
|---|---|
| PubChem CID | 165006297 |
| Molecular Formula | C29H35FN4 |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | 1-[6-[(1S,3R)-2-(1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-1-yl]-3-pyridinyl]-N-(3-fluoropropyl)azetidin-3-amine |
| SMILES | C[C@@H]1CC2=C(Cc3ccccc32)[C@@H](c2ccc(N3CC(NCCCF)C3)cn2)N1C12CC(C1)C2 |
| InChI | InChI=1S/C29H35FN4/c1-19-11-25-24-6-3-2-5-21(24)12-26(25)28(34(19)29-13-20(14-29)15-29)27-8-7-23(16-32-27)33-17-22(18-33)31-10-4-9-30/h2-3,5-8,16,19-20,22,28,31H,4,9-15,17-18H2,1H3/t19-,20?,28+,29?/m1/s1 |
| InChIKey | PTDFLYOFLIJERF-SSPOUZMTSA-N |
| XLogP | 4.92 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|