C18H15N5O3S — CID 165007837
4-[5-(4-methylphenyl)tetrazol-1-yl]sulfonyl-N-prop-2-ynylbenzamide (PubChem CID 165007837) has the molecular formula C18H15N5O3S and a molecular weight of 381.42 g/mol. Its IUPAC name is 4-[5-(4-methylphenyl)tetrazol-1-yl]sulfonyl-N-prop-2-ynylbenzamide.
| Compound Name | 4-[5-(4-methylphenyl)tetrazol-1-yl]sulfonyl-N-prop-2-ynylbenzamide |
|---|---|
| PubChem CID | 165007837 |
| Molecular Formula | C18H15N5O3S |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 4-[5-(4-methylphenyl)tetrazol-1-yl]sulfonyl-N-prop-2-ynylbenzamide |
| SMILES | C#CCNC(=O)c1ccc(S(=O)(=O)n2nnnc2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H15N5O3S/c1-3-12-19-18(24)15-8-10-16(11-9-15)27(25,26)23-17(20-21-22-23)14-6-4-13(2)5-7-14/h1,4-11H,12H2,2H3,(H,19,24) |
| InChIKey | KXZLBGSXJXPROG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|