About carbanylium;methyl dihydrogen phosphate
carbanylium;methyl dihydrogen phosphate (PubChem CID 165007935) has the molecular formula C3H11O4P+2
and a molecular weight of 142.09 g/mol. Its IUPAC name is carbanylium;methyl dihydrogen phosphate.
Molecular Properties
| Compound Name | carbanylium;methyl dihydrogen phosphate |
| PubChem CID | 165007935 |
| Molecular Formula | C3H11O4P+2 |
| Molecular Weight | 142.09 g/mol |
| Exact Mass | 142.04 |
| IUPAC Name | carbanylium;methyl dihydrogen phosphate |
| SMILES | COP(=O)(O)O.[CH3+].[CH3+] |
| InChI | InChI=1S/CH5O4P.2CH3/c1-5-6(2,3)4;;/h1H3,(H2,2,3,4);2*1H3/q;2*+1 |
| InChIKey | JGFAMDCUVGOHFC-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.09 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze carbanylium;methyl dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanylium;methyl dihydrogen phosphate?
The IUPAC name of carbanylium;methyl dihydrogen phosphate (CID 165007935) is carbanylium;methyl dihydrogen phosphate.
What is the SMILES notation for carbanylium;methyl dihydrogen phosphate?
The canonical SMILES for carbanylium;methyl dihydrogen phosphate is COP(=O)(O)O.[CH3+].[CH3+].
What is the InChIKey of carbanylium;methyl dihydrogen phosphate?
The InChIKey is JGFAMDCUVGOHFC-UHFFFAOYSA-N. The full InChI is InChI=1S/CH5O4P.2CH3/c1-5-6(2,3)4;;/h1H3,(H2,2,3,4);2*1H3/q;2*+1.
What are the key properties of carbanylium;methyl dihydrogen phosphate?
carbanylium;methyl dihydrogen phosphate has a molecular weight of 142.09 g/mol, XLogP of 0.63, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanylium;methyl dihydrogen phosphate is sourced from PubChem (CID 165007935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).