C33H63F6N3 — CID 165008759
bis(2,2-difluoro-1,4-di(propan-2-yl)piperidine);3,3-difluoro-1,4-di(propan-2-yl)piperidine (PubChem CID 165008759) has the molecular formula C33H63F6N3 and a molecular weight of 615.88 g/mol. Its IUPAC name is bis(2,2-difluoro-1,4-di(propan-2-yl)piperidine);3,3-difluoro-1,4-di(propan-2-yl)piperidine.
| Compound Name | bis(2,2-difluoro-1,4-di(propan-2-yl)piperidine);3,3-difluoro-1,4-di(propan-2-yl)piperidine |
|---|---|
| PubChem CID | 165008759 |
| Molecular Formula | C33H63F6N3 |
| Molecular Weight | 615.88 g/mol |
| Exact Mass | 615.49 |
| IUPAC Name | bis(2,2-difluoro-1,4-di(propan-2-yl)piperidine);3,3-difluoro-1,4-di(propan-2-yl)piperidine |
| SMILES | CC(C)C1CCN(C(C)C)C(F)(F)C1.CC(C)C1CCN(C(C)C)C(F)(F)C1.CC(C)C1CCN(C(C)C)CC1(F)F |
| InChI | InChI=1S/3C11H21F2N/c1-8(2)10-5-6-14(9(3)4)7-11(10,12)13;2*1-8(2)10-5-6-14(9(3)4)11(12,13)7-10/h3*8-10H,5-7H2,1-4H3 |
| InChIKey | JJFSAYDINRBVNQ-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.88 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|