C14H22 — CID 165009215
(1aS,2aR)-3,5a-diethyl-1a,2,2a,3,6,6a-hexahydro-1H-cyclopropa[f]indene (PubChem CID 165009215) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is (1aS,2aR)-3,5a-diethyl-1a,2,2a,3,6,6a-hexahydro-1H-cyclopropa[f]indene.
| Compound Name | (1aS,2aR)-3,5a-diethyl-1a,2,2a,3,6,6a-hexahydro-1H-cyclopropa[f]indene |
|---|---|
| PubChem CID | 165009215 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | (1aS,2aR)-3,5a-diethyl-1a,2,2a,3,6,6a-hexahydro-1H-cyclopropa[f]indene |
| SMILES | CCC1C=CC2(CC)CC3C[C@H]3C[C@H]12 |
| InChI | InChI=1S/C14H22/c1-3-10-5-6-14(4-2)9-12-7-11(12)8-13(10)14/h5-6,10-13H,3-4,7-9H2,1-2H3/t10?,11-,12?,13+,14?/m0/s1 |
| InChIKey | JLAPVXNTANATCS-KSODFNGISA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|