C28H36F2N2O6SSi — CID 165009420
1-[3-(difluoromethoxy)phenyl]-5-[2-(4-methyl-1,1-dioxothian-4-yl)acetyl]-3-(2-trimethylsilylethoxymethyl)benzimidazol-2-one (PubChem CID 165009420) has the molecular formula C28H36F2N2O6SSi and a molecular weight of 594.75 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)phenyl]-5-[2-(4-methyl-1,1-dioxothian-4-yl)acetyl]-3-(2-trimethylsilylethoxymethyl)benzimidazol-2-one.
| Compound Name | 1-[3-(difluoromethoxy)phenyl]-5-[2-(4-methyl-1,1-dioxothian-4-yl)acetyl]-3-(2-trimethylsilylethoxymethyl)benzimidazol-2-one |
|---|---|
| PubChem CID | 165009420 |
| Molecular Formula | C28H36F2N2O6SSi |
| Molecular Weight | 594.75 g/mol |
| Exact Mass | 594.20 |
| IUPAC Name | 1-[3-(difluoromethoxy)phenyl]-5-[2-(4-methyl-1,1-dioxothian-4-yl)acetyl]-3-(2-trimethylsilylethoxymethyl)benzimidazol-2-one |
| SMILES | CC1(CC(=O)c2ccc3c(c2)n(COCC[Si](C)(C)C)c(=O)n3-c2cccc(OC(F)F)c2)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C28H36F2N2O6SSi/c1-28(10-13-39(35,36)14-11-28)18-25(33)20-8-9-23-24(16-20)31(19-37-12-15-40(2,3)4)27(34)32(23)21-6-5-7-22(17-21)38-26(29)30/h5-9,16-17,26H,10-15,18-19H2,1-4H3 |
| InChIKey | VLENKPIGXYOJIR-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 96.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.75 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|