C24H29NO4 — CID 165009534
(8R,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol;pyridine-3-carboxylic acid (PubChem CID 165009534) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is (8R,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol;pyridine-3-carboxylic acid.
| Compound Name | (8R,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol;pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 165009534 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | (8R,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol;pyridine-3-carboxylic acid |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CCC2O.O=C(O)c1cccnc1 |
| InChI | InChI=1S/C18H24O2.C6H5NO2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20;8-6(9)5-2-1-3-7-4-5/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3;1-4H,(H,8,9)/t14-,15-,16+,17?,18+;/m1./s1 |
| InChIKey | JMEZTEGCYRAQHV-WAJSLEGFSA-N |
| XLogP | 4.39 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |