About CID 165009690
CID 165009690 (PubChem CID 165009690) has the molecular formula C50H54N4O4S2
and a molecular weight of 839.14 g/mol.
Molecular Properties
| Compound Name | CID 165009690 |
| PubChem CID | 165009690 |
| Molecular Formula | C50H54N4O4S2 |
| Molecular Weight | 839.14 g/mol |
| Exact Mass | 838.36 |
| IUPAC Name | — |
| SMILES | O=C1C(=Nc2nc3c(s2)-c2cc4c(cc2C32CCCCC2)-c2sc(N=C3C(=O)C5CC6CCCCC6CC5C3=O)nc2C42CCCCC2)C(=O)C2CC3CCCCC3CC12 |
| InChI | InChI=1S/C50H54N4O4S2/c55-39-29-19-25-11-3-4-12-26(25)20-30(29)40(56)37(39)51-47-53-45-43(59-47)33-24-36-34(23-35(33)49(45)15-7-1-8-16-49)44-46(50(36)17-9-2-10-18-50)54-48(60-44)52-38-41(57)31-21-27-13-5-6-14-28(27)22-32(31)42(38)58/h23-32H,1-22H2 |
| InChIKey | JRBIUKWPAUTQMM-UHFFFAOYSA-N |
| XLogP | 11.17 |
| TPSA | 118.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 60 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 839.14 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 165009690 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 165009690?
The IUPAC name of CID 165009690 (CID 165009690) is not available.
What is the SMILES notation for CID 165009690?
The canonical SMILES for CID 165009690 is O=C1C(=Nc2nc3c(s2)-c2cc4c(cc2C32CCCCC2)-c2sc(N=C3C(=O)C5CC6CCCCC6CC5C3=O)nc2C42CCCCC2)C(=O)C2CC3CCCCC3CC12.
What is the InChIKey of CID 165009690?
The InChIKey is JRBIUKWPAUTQMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C50H54N4O4S2/c55-39-29-19-25-11-3-4-12-26(25)20-30(29)40(56)37(39)51-47-53-45-43(59-47)33-24-36-34(23-35(33)49(45)15-7-1-8-16-49)44-46(50(36)17-9-2-10-18-50)54-48(60-44)52-38-41(57)31-21-27-13-5-6-14-28(27)22-32(31)42(38)58/h23-32H,1-22H2.
What are the key properties of CID 165009690?
CID 165009690 has a molecular weight of 839.14 g/mol, XLogP of 11.17, 2 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 165009690 is sourced from PubChem (CID 165009690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).