C26H10N8S5 — CID 165009755
N-[5-[5-[5-(dicyanomethylideneamino)thiophen-2-yl]-2,8-dimethyl-6,11,15-trithia-4,13-diazatetracyclo[7.6.0.03,7.010,14]pentadeca-1,3(7),4,8,10(14),12-hexaen-12-yl]thiophen-2-yl]-1-isocyanomethanimidoyl cyanide (PubChem CID 165009755) has the molecular formula C26H10N8S5 and a molecular weight of 594.76 g/mol. Its IUPAC name is N-[5-[5-[5-(dicyanomethylideneamino)thiophen-2-yl]-2,8-dimethyl-6,11,15-trithia-4,13-diazatetracyclo[7.6.0.03,7.010,14]pentadeca-1,3(7),4,8,10(14),12-hexaen-12-yl]thiophen-2-yl]-1-isocyanomethanimidoyl cyanide.
| Compound Name | N-[5-[5-[5-(dicyanomethylideneamino)thiophen-2-yl]-2,8-dimethyl-6,11,15-trithia-4,13-diazatetracyclo[7.6.0.03,7.010,14]pentadeca-1,3(7),4,8,10(14),12-hexaen-12-yl]thiophen-2-yl]-1-isocyanomethanimidoyl cyanide |
|---|---|
| PubChem CID | 165009755 |
| Molecular Formula | C26H10N8S5 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 593.96 |
| IUPAC Name | N-[5-[5-[5-(dicyanomethylideneamino)thiophen-2-yl]-2,8-dimethyl-6,11,15-trithia-4,13-diazatetracyclo[7.6.0.03,7.010,14]pentadeca-1,3(7),4,8,10(14),12-hexaen-12-yl]thiophen-2-yl]-1-isocyanomethanimidoyl cyanide |
| SMILES | [C-]#[N+]C(C#N)=Nc1ccc(-c2nc3sc4c(C)c5nc(-c6ccc(N=C(C#N)C#N)s6)sc5c(C)c4c3s2)s1 |
| InChI | InChI=1S/C26H10N8S5/c1-11-19-21(37-26-23(19)39-25(34-26)15-5-7-18(36-15)32-16(10-29)30-3)12(2)20-22(11)38-24(33-20)14-4-6-17(35-14)31-13(8-27)9-28/h4-7H,1-2H3 |
| InChIKey | ZTSDJGKWCGAUGL-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 126.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|