C6H10F5NO2S — CID 165009901
N-(2,2-difluoropentyl)-1,1,1-trifluoromethanesulfonamide (PubChem CID 165009901) has the molecular formula C6H10F5NO2S and a molecular weight of 255.21 g/mol. Its IUPAC name is N-(2,2-difluoropentyl)-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-(2,2-difluoropentyl)-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 165009901 |
| Molecular Formula | C6H10F5NO2S |
| Molecular Weight | 255.21 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | N-(2,2-difluoropentyl)-1,1,1-trifluoromethanesulfonamide |
| SMILES | CCCC(F)(F)CNS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C6H10F5NO2S/c1-2-3-5(7,8)4-12-15(13,14)6(9,10)11/h12H,2-4H2,1H3 |
| InChIKey | OSACAHDWKGSGJH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.21 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |