C24H24N6O — CID 165010325
2-[1-[(4-aminophenyl)methyl]pyrazol-4-yl]-1-[(13R)-13-methyl-10-methylidene-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-4-yl]ethanone (PubChem CID 165010325) has the molecular formula C24H24N6O and a molecular weight of 412.50 g/mol. Its IUPAC name is 2-[1-[(4-aminophenyl)methyl]pyrazol-4-yl]-1-[(13R)-13-methyl-10-methylidene-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-4-yl]ethanone.
| Compound Name | 2-[1-[(4-aminophenyl)methyl]pyrazol-4-yl]-1-[(13R)-13-methyl-10-methylidene-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-4-yl]ethanone |
|---|---|
| PubChem CID | 165010325 |
| Molecular Formula | C24H24N6O |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 2-[1-[(4-aminophenyl)methyl]pyrazol-4-yl]-1-[(13R)-13-methyl-10-methylidene-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-4-yl]ethanone |
| SMILES | C=C1NC[C@@H](C)n2c1cc1ccc(C(=O)Cc3cnn(Cc4ccc(N)cc4)c3)nc12 |
| InChI | InChI=1S/C24H24N6O/c1-15-11-26-16(2)22-10-19-5-8-21(28-24(19)30(15)22)23(31)9-18-12-27-29(14-18)13-17-3-6-20(25)7-4-17/h3-8,10,12,14-15,26H,2,9,11,13,25H2,1H3/t15-/m1/s1 |
| InChIKey | JPJMXWRKEQPTCU-OAHLLOKOSA-N |
| XLogP | 3.42 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|