C22H28FNO2 — CID 165010571
(2-methoxy-3-methylphenyl)-[2,2,3,3,4,5,5,6,6-nonadeuterio-1-[1,1,2,2-tetradeuterio-2-(4-fluorophenyl)ethyl]piperidin-4-yl]methanol (PubChem CID 165010571) has the molecular formula C22H28FNO2 and a molecular weight of 370.55 g/mol. Its IUPAC name is (2-methoxy-3-methylphenyl)-[2,2,3,3,4,5,5,6,6-nonadeuterio-1-[1,1,2,2-tetradeuterio-2-(4-fluorophenyl)ethyl]piperidin-4-yl]methanol.
| Compound Name | (2-methoxy-3-methylphenyl)-[2,2,3,3,4,5,5,6,6-nonadeuterio-1-[1,1,2,2-tetradeuterio-2-(4-fluorophenyl)ethyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 165010571 |
| Molecular Formula | C22H28FNO2 |
| Molecular Weight | 370.55 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | (2-methoxy-3-methylphenyl)-[2,2,3,3,4,5,5,6,6-nonadeuterio-1-[1,1,2,2-tetradeuterio-2-(4-fluorophenyl)ethyl]piperidin-4-yl]methanol |
| SMILES | [2H]C([2H])(c1ccc(F)cc1)C([2H])([2H])N1C([2H])([2H])C([2H])([2H])C([2H])(C(O)c2cccc(C)c2OC)C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C22H28FNO2/c1-16-4-3-5-20(22(16)26-2)21(25)18-11-14-24(15-12-18)13-10-17-6-8-19(23)9-7-17/h3-9,18,21,25H,10-15H2,1-2H3/i10D2,11D2,12D2,13D2,14D2,15D2,18D |
| InChIKey | PKPHMNYZEJYJGG-GKHSLINVSA-N |
| XLogP | 4.13 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |