About N-(oxolan-2-ylmethyl)-4-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-1-amine
N-(oxolan-2-ylmethyl)-4-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-1-amine (PubChem CID 165011287) has the molecular formula C19H17F3N4O
and a molecular weight of 374.37 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-4-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-1-amine.
Molecular Properties
| Compound Name | N-(oxolan-2-ylmethyl)-4-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-1-amine |
| PubChem CID | 165011287 |
| Molecular Formula | C19H17F3N4O |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-4-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-1-amine |
| SMILES | FC(F)(F)c1ccc(-c2nnc(NCC3CCCO3)c3ccncc23)cc1 |
| InChI | InChI=1S/C19H17F3N4O/c20-19(21,22)13-5-3-12(4-6-13)17-16-11-23-8-7-15(16)18(26-25-17)24-10-14-2-1-9-27-14/h3-8,11,14H,1-2,9-10H2,(H,24,26) |
| InChIKey | JTBAJCNBDHGLGL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(oxolan-2-ylmethyl)-4-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(oxolan-2-ylmethyl)-4-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-1-amine?
The IUPAC name of N-(oxolan-2-ylmethyl)-4-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-1-amine (CID 165011287) is N-(oxolan-2-ylmethyl)-4-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-1-amine.
What is the SMILES notation for N-(oxolan-2-ylmethyl)-4-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-1-amine?
The canonical SMILES for N-(oxolan-2-ylmethyl)-4-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-1-amine is FC(F)(F)c1ccc(-c2nnc(NCC3CCCO3)c3ccncc23)cc1.
What is the InChIKey of N-(oxolan-2-ylmethyl)-4-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-1-amine?
The InChIKey is JTBAJCNBDHGLGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17F3N4O/c20-19(21,22)13-5-3-12(4-6-13)17-16-11-23-8-7-15(16)18(26-25-17)24-10-14-2-1-9-27-14/h3-8,11,14H,1-2,9-10H2,(H,24,26).
What are the key properties of N-(oxolan-2-ylmethyl)-4-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-1-amine?
N-(oxolan-2-ylmethyl)-4-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-1-amine has a molecular weight of 374.37 g/mol, XLogP of 4.30, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(oxolan-2-ylmethyl)-4-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-1-amine is sourced from PubChem (CID 165011287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).