C10H10N4O3S2 — CID 165011337
N-methylsulfonyl-2-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]ethanimidate (PubChem CID 165011337) has the molecular formula C10H10N4O3S2 and a molecular weight of 298.35 g/mol. Its IUPAC name is N-methylsulfonyl-2-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]ethanimidate.
| Compound Name | N-methylsulfonyl-2-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]ethanimidate |
|---|---|
| PubChem CID | 165011337 |
| Molecular Formula | C10H10N4O3S2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | N-methylsulfonyl-2-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]ethanimidate |
| SMILES | CS(=O)(=O)N=C([O-])C[n+]1ccc(-c2ncns2)cc1 |
| InChI | InChI=1S/C10H10N4O3S2/c1-19(16,17)13-9(15)6-14-4-2-8(3-5-14)10-11-7-12-18-10/h2-5,7H,6H2,1H3 |
| InChIKey | JTHHWFGOQXRJOT-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 99.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|