C22H23NO4 — CID 165012570
4-[7-(4-methoxybutyl)benzo[e][1,2]benzoxazol-1-yl]cyclohexane-1,3-dione (PubChem CID 165012570) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is 4-[7-(4-methoxybutyl)benzo[e][1,2]benzoxazol-1-yl]cyclohexane-1,3-dione.
| Compound Name | 4-[7-(4-methoxybutyl)benzo[e][1,2]benzoxazol-1-yl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 165012570 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 4-[7-(4-methoxybutyl)benzo[e][1,2]benzoxazol-1-yl]cyclohexane-1,3-dione |
| SMILES | COCCCCc1ccc2c(ccc3onc(C4CCC(=O)CC4=O)c32)c1 |
| InChI | InChI=1S/C22H23NO4/c1-26-11-3-2-4-14-5-8-17-15(12-14)6-10-20-21(17)22(23-27-20)18-9-7-16(24)13-19(18)25/h5-6,8,10,12,18H,2-4,7,9,11,13H2,1H3 |
| InChIKey | KFWVZGZHYCTUDP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|