About 2-methyl-6-[3-[2-(trifluoromethyl)anilino]prop-1-ynyl]-1,3-benzothiazol-4-ol
2-methyl-6-[3-[2-(trifluoromethyl)anilino]prop-1-ynyl]-1,3-benzothiazol-4-ol (PubChem CID 165012838) has the molecular formula C18H13F3N2OS
and a molecular weight of 362.38 g/mol. Its IUPAC name is 2-methyl-6-[3-[2-(trifluoromethyl)anilino]prop-1-ynyl]-1,3-benzothiazol-4-ol.
Molecular Properties
| Compound Name | 2-methyl-6-[3-[2-(trifluoromethyl)anilino]prop-1-ynyl]-1,3-benzothiazol-4-ol |
| PubChem CID | 165012838 |
| Molecular Formula | C18H13F3N2OS |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 2-methyl-6-[3-[2-(trifluoromethyl)anilino]prop-1-ynyl]-1,3-benzothiazol-4-ol |
| SMILES | Cc1nc2c(O)cc(C#CCNc3ccccc3C(F)(F)F)cc2s1 |
| InChI | InChI=1S/C18H13F3N2OS/c1-11-23-17-15(24)9-12(10-16(17)25-11)5-4-8-22-14-7-3-2-6-13(14)18(19,20)21/h2-3,6-7,9-10,22,24H,8H2,1H3 |
| InChIKey | NPQYHLLFOVEMKJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-6-[3-[2-(trifluoromethyl)anilino]prop-1-ynyl]-1,3-benzothiazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-[3-[2-(trifluoromethyl)anilino]prop-1-ynyl]-1,3-benzothiazol-4-ol?
The IUPAC name of 2-methyl-6-[3-[2-(trifluoromethyl)anilino]prop-1-ynyl]-1,3-benzothiazol-4-ol (CID 165012838) is 2-methyl-6-[3-[2-(trifluoromethyl)anilino]prop-1-ynyl]-1,3-benzothiazol-4-ol.
What is the SMILES notation for 2-methyl-6-[3-[2-(trifluoromethyl)anilino]prop-1-ynyl]-1,3-benzothiazol-4-ol?
The canonical SMILES for 2-methyl-6-[3-[2-(trifluoromethyl)anilino]prop-1-ynyl]-1,3-benzothiazol-4-ol is Cc1nc2c(O)cc(C#CCNc3ccccc3C(F)(F)F)cc2s1.
What is the InChIKey of 2-methyl-6-[3-[2-(trifluoromethyl)anilino]prop-1-ynyl]-1,3-benzothiazol-4-ol?
The InChIKey is NPQYHLLFOVEMKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F3N2OS/c1-11-23-17-15(24)9-12(10-16(17)25-11)5-4-8-22-14-7-3-2-6-13(14)18(19,20)21/h2-3,6-7,9-10,22,24H,8H2,1H3.
What are the key properties of 2-methyl-6-[3-[2-(trifluoromethyl)anilino]prop-1-ynyl]-1,3-benzothiazol-4-ol?
2-methyl-6-[3-[2-(trifluoromethyl)anilino]prop-1-ynyl]-1,3-benzothiazol-4-ol has a molecular weight of 362.38 g/mol, XLogP of 4.79, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-[3-[2-(trifluoromethyl)anilino]prop-1-ynyl]-1,3-benzothiazol-4-ol is sourced from PubChem (CID 165012838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).