About CID 165013643
CID 165013643 (PubChem CID 165013643) has the molecular formula C42H31F3N2O4S2
and a molecular weight of 748.85 g/mol.
Molecular Properties
| Compound Name | CID 165013643 |
| PubChem CID | 165013643 |
| Molecular Formula | C42H31F3N2O4S2 |
| Molecular Weight | 748.85 g/mol |
| Exact Mass | 748.17 |
| IUPAC Name | — |
| SMILES | Cc1ccc2c(c1)/C(=C/c1nc3c(s1)C1=C(c4sc(/C=C5\C(=O)C(=O)c6ccc(C(F)(F)F)cc65)nc4C14CCCCC4)C31CCCCC1)C(=O)C2=O |
| InChI | InChI=1S/C42H31F3N2O4S2/c1-20-8-10-22-24(16-20)26(34(50)32(22)48)18-28-46-38-36(52-28)30-31(40(38)12-4-2-5-13-40)37-39(41(30)14-6-3-7-15-41)47-29(53-37)19-27-25-17-21(42(43,44)45)9-11-23(25)33(49)35(27)51/h8-11,16-19H,2-7,12-15H2,1H3/b26-18-,27-19- |
| InChIKey | RWTFOVRLKRJFDV-WCOOBMQKSA-N |
| XLogP | 9.88 |
| TPSA | 94.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 748.85 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 165013643 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 165013643?
The IUPAC name of CID 165013643 (CID 165013643) is not available.
What is the SMILES notation for CID 165013643?
The canonical SMILES for CID 165013643 is Cc1ccc2c(c1)/C(=C/c1nc3c(s1)C1=C(c4sc(/C=C5\C(=O)C(=O)c6ccc(C(F)(F)F)cc65)nc4C14CCCCC4)C31CCCCC1)C(=O)C2=O.
What is the InChIKey of CID 165013643?
The InChIKey is RWTFOVRLKRJFDV-WCOOBMQKSA-N. The full InChI is InChI=1S/C42H31F3N2O4S2/c1-20-8-10-22-24(16-20)26(34(50)32(22)48)18-28-46-38-36(52-28)30-31(40(38)12-4-2-5-13-40)37-39(41(30)14-6-3-7-15-41)47-29(53-37)19-27-25-17-21(42(43,44)45)9-11-23(25)33(49)35(27)51/h8-11,16-19H,2-7,12-15H2,1H3/b26-18-,27-19-.
What are the key properties of CID 165013643?
CID 165013643 has a molecular weight of 748.85 g/mol, XLogP of 9.88, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 165013643 is sourced from PubChem (CID 165013643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).