C19H16F4N2O3S2 — CID 165014099
(12S)-8-(4-fluorophenyl)-12-methoxy-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-triene-2,4-dione;sulfane (PubChem CID 165014099) has the molecular formula C19H16F4N2O3S2 and a molecular weight of 460.47 g/mol. Its IUPAC name is (12S)-8-(4-fluorophenyl)-12-methoxy-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-triene-2,4-dione;sulfane.
| Compound Name | (12S)-8-(4-fluorophenyl)-12-methoxy-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-triene-2,4-dione;sulfane |
|---|---|
| PubChem CID | 165014099 |
| Molecular Formula | C19H16F4N2O3S2 |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | (12S)-8-(4-fluorophenyl)-12-methoxy-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-triene-2,4-dione;sulfane |
| SMILES | CO[C@@H]1CSc2c(-c3ccc(F)cc3)c(C(F)(F)F)cc3c(=O)[nH]c(=O)n(c23)C1.S |
| InChI | InChI=1S/C19H14F4N2O3S.H2S/c1-28-11-7-25-15-12(17(26)24-18(25)27)6-13(19(21,22)23)14(16(15)29-8-11)9-2-4-10(20)5-3-9;/h2-6,11H,7-8H2,1H3,(H,24,26,27);1H2/t11-;/m0./s1 |
| InChIKey | KDMHBTIALGWDTH-MERQFXBCSA-N |
| XLogP | 3.75 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |