C30H32N10OS2 — CID 165014240
2-[[6-ethyl-2-[7-[2-(3-isocyanoazetidin-1-yl)-2-oxoethyl]-2,7-diazaspiro[3.4]octan-2-yl]imidazo[2,1-b][1,3,4]thiadiazol-5-yl]-methylamino]-4-(4-methylphenyl)-1,3-thiazole-5-carbonitrile (PubChem CID 165014240) has the molecular formula C30H32N10OS2 and a molecular weight of 612.79 g/mol. Its IUPAC name is 2-[[6-ethyl-2-[7-[2-(3-isocyanoazetidin-1-yl)-2-oxoethyl]-2,7-diazaspiro[3.4]octan-2-yl]imidazo[2,1-b][1,3,4]thiadiazol-5-yl]-methylamino]-4-(4-methylphenyl)-1,3-thiazole-5-carbonitrile.
| Compound Name | 2-[[6-ethyl-2-[7-[2-(3-isocyanoazetidin-1-yl)-2-oxoethyl]-2,7-diazaspiro[3.4]octan-2-yl]imidazo[2,1-b][1,3,4]thiadiazol-5-yl]-methylamino]-4-(4-methylphenyl)-1,3-thiazole-5-carbonitrile |
|---|---|
| PubChem CID | 165014240 |
| Molecular Formula | C30H32N10OS2 |
| Molecular Weight | 612.79 g/mol |
| Exact Mass | 612.22 |
| IUPAC Name | 2-[[6-ethyl-2-[7-[2-(3-isocyanoazetidin-1-yl)-2-oxoethyl]-2,7-diazaspiro[3.4]octan-2-yl]imidazo[2,1-b][1,3,4]thiadiazol-5-yl]-methylamino]-4-(4-methylphenyl)-1,3-thiazole-5-carbonitrile |
| SMILES | [C-]#[N+]C1CN(C(=O)CN2CCC3(C2)CN(c2nn4c(N(C)c5nc(-c6ccc(C)cc6)c(C#N)s5)c(CC)nc4s2)C3)C1 |
| InChI | InChI=1S/C30H32N10OS2/c1-5-22-26(36(4)27-34-25(23(12-31)42-27)20-8-6-19(2)7-9-20)40-28(33-22)43-29(35-40)39-17-30(18-39)10-11-37(16-30)15-24(41)38-13-21(14-38)32-3/h6-9,21H,5,10-11,13-18H2,1-2,4H3 |
| InChIKey | HLVFUALZBWGSHJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 101.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.79 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|