C13H22Br2O4 — CID 165015507
(4R,5R,6R)-1,1-dibromo-4,6-bis(methoxymethoxy)-5-methylocta-1,7-diene (PubChem CID 165015507) has the molecular formula C13H22Br2O4 and a molecular weight of 402.12 g/mol. Its IUPAC name is (4R,5R,6R)-1,1-dibromo-4,6-bis(methoxymethoxy)-5-methylocta-1,7-diene.
| Compound Name | (4R,5R,6R)-1,1-dibromo-4,6-bis(methoxymethoxy)-5-methylocta-1,7-diene |
|---|---|
| PubChem CID | 165015507 |
| Molecular Formula | C13H22Br2O4 |
| Molecular Weight | 402.12 g/mol |
| Exact Mass | 399.99 |
| IUPAC Name | (4R,5R,6R)-1,1-dibromo-4,6-bis(methoxymethoxy)-5-methylocta-1,7-diene |
| SMILES | C=C[C@@H](OCOC)[C@H](C)[C@@H](CC=C(Br)Br)OCOC |
| InChI | InChI=1S/C13H22Br2O4/c1-5-11(18-8-16-3)10(2)12(19-9-17-4)6-7-13(14)15/h5,7,10-12H,1,6,8-9H2,2-4H3/t10-,11+,12+/m0/s1 |
| InChIKey | NBOHEQLBGHXTEN-QJPTWQEYSA-N |
| XLogP | 3.81 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.12 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|