C20H15NO6 — CID 165015625
3-(3,4,5-trimethoxyphenyl)benzo[f][1,2]benzoxazole-4,9-dione (PubChem CID 165015625) has the molecular formula C20H15NO6 and a molecular weight of 365.34 g/mol. Its IUPAC name is 3-(3,4,5-trimethoxyphenyl)benzo[f][1,2]benzoxazole-4,9-dione.
| Compound Name | 3-(3,4,5-trimethoxyphenyl)benzo[f][1,2]benzoxazole-4,9-dione |
|---|---|
| PubChem CID | 165015625 |
| Molecular Formula | C20H15NO6 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 3-(3,4,5-trimethoxyphenyl)benzo[f][1,2]benzoxazole-4,9-dione |
| SMILES | COc1cc(-c2noc3c2C(=O)c2ccccc2C3=O)cc(OC)c1OC |
| InChI | InChI=1S/C20H15NO6/c1-24-13-8-10(9-14(25-2)19(13)26-3)16-15-17(22)11-6-4-5-7-12(11)18(23)20(15)27-21-16/h4-9H,1-3H3 |
| InChIKey | KJJDDEITJYGFSV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 87.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|