About cyclopropyl acetate;N-phenylacetamide;N-pyridin-3-ylacetamide
cyclopropyl acetate;N-phenylacetamide;N-pyridin-3-ylacetamide (PubChem CID 165016766) has the molecular formula C20H25N3O4
and a molecular weight of 371.44 g/mol. Its IUPAC name is cyclopropyl acetate;N-phenylacetamide;N-pyridin-3-ylacetamide.
Molecular Properties
| Compound Name | cyclopropyl acetate;N-phenylacetamide;N-pyridin-3-ylacetamide |
| PubChem CID | 165016766 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | cyclopropyl acetate;N-phenylacetamide;N-pyridin-3-ylacetamide |
| SMILES | CC(=O)Nc1ccccc1.CC(=O)Nc1cccnc1.CC(=O)OC1CC1 |
| InChI | InChI=1S/C8H9NO.C7H8N2O.C5H8O2/c1-7(10)9-8-5-3-2-4-6-8;1-6(10)9-7-3-2-4-8-5-7;1-4(6)7-5-2-3-5/h2-6H,1H3,(H,9,10);2-5H,1H3,(H,9,10);5H,2-3H2,1H3 |
| InChIKey | KNTKLGGEWMEKFO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclopropyl acetate;N-phenylacetamide;N-pyridin-3-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl acetate;N-phenylacetamide;N-pyridin-3-ylacetamide?
The IUPAC name of cyclopropyl acetate;N-phenylacetamide;N-pyridin-3-ylacetamide (CID 165016766) is cyclopropyl acetate;N-phenylacetamide;N-pyridin-3-ylacetamide.
What is the SMILES notation for cyclopropyl acetate;N-phenylacetamide;N-pyridin-3-ylacetamide?
The canonical SMILES for cyclopropyl acetate;N-phenylacetamide;N-pyridin-3-ylacetamide is CC(=O)Nc1ccccc1.CC(=O)Nc1cccnc1.CC(=O)OC1CC1.
What is the InChIKey of cyclopropyl acetate;N-phenylacetamide;N-pyridin-3-ylacetamide?
The InChIKey is KNTKLGGEWMEKFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO.C7H8N2O.C5H8O2/c1-7(10)9-8-5-3-2-4-6-8;1-6(10)9-7-3-2-4-8-5-7;1-4(6)7-5-2-3-5/h2-6H,1H3,(H,9,10);2-5H,1H3,(H,9,10);5H,2-3H2,1H3.
What are the key properties of cyclopropyl acetate;N-phenylacetamide;N-pyridin-3-ylacetamide?
cyclopropyl acetate;N-phenylacetamide;N-pyridin-3-ylacetamide has a molecular weight of 371.44 g/mol, XLogP of 3.40, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl acetate;N-phenylacetamide;N-pyridin-3-ylacetamide is sourced from PubChem (CID 165016766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).