C26H34N4O — CID 165017215
4-[2-[1-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperidin-4-yl]ethyl]-N,N-dimethylaniline (PubChem CID 165017215) has the molecular formula C26H34N4O and a molecular weight of 418.59 g/mol. Its IUPAC name is 4-[2-[1-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperidin-4-yl]ethyl]-N,N-dimethylaniline.
| Compound Name | 4-[2-[1-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperidin-4-yl]ethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 165017215 |
| Molecular Formula | C26H34N4O |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | 4-[2-[1-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperidin-4-yl]ethyl]-N,N-dimethylaniline |
| SMILES | COc1ccc2nccc(CCN3CCC(CCc4ccc(N(C)C)cc4)CC3)c2n1 |
| InChI | InChI=1S/C26H34N4O/c1-29(2)23-8-6-20(7-9-23)4-5-21-13-17-30(18-14-21)19-15-22-12-16-27-24-10-11-25(31-3)28-26(22)24/h6-12,16,21H,4-5,13-15,17-19H2,1-3H3 |
| InChIKey | KPOJDRXEEMUZAC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|