C43H69N3O14 — CID 165017908
tert-butyl 7-acetyl-2-amino-10-[2-[2-[2-[(5,13-diacetyl-2,7,11,16-tetraoxoheptadecan-8-yl)amino]-2-oxoethoxy]ethoxy]ethylamino]-5,10-dioxodecanoate (PubChem CID 165017908) has the molecular formula C43H69N3O14 and a molecular weight of 852.03 g/mol. Its IUPAC name is tert-butyl 7-acetyl-2-amino-10-[2-[2-[2-[(5,13-diacetyl-2,7,11,16-tetraoxoheptadecan-8-yl)amino]-2-oxoethoxy]ethoxy]ethylamino]-5,10-dioxodecanoate.
| Compound Name | tert-butyl 7-acetyl-2-amino-10-[2-[2-[2-[(5,13-diacetyl-2,7,11,16-tetraoxoheptadecan-8-yl)amino]-2-oxoethoxy]ethoxy]ethylamino]-5,10-dioxodecanoate |
|---|---|
| PubChem CID | 165017908 |
| Molecular Formula | C43H69N3O14 |
| Molecular Weight | 852.03 g/mol |
| Exact Mass | 851.48 |
| IUPAC Name | tert-butyl 7-acetyl-2-amino-10-[2-[2-[2-[(5,13-diacetyl-2,7,11,16-tetraoxoheptadecan-8-yl)amino]-2-oxoethoxy]ethoxy]ethylamino]-5,10-dioxodecanoate |
| SMILES | CC(=O)CCC(CC(=O)CCC(NC(=O)COCCOCCNC(=O)CCC(CC(=O)CCC(N)C(=O)OC(C)(C)C)C(C)=O)C(=O)CC(CCC(C)=O)C(C)=O)C(C)=O |
| InChI | InChI=1S/C43H69N3O14/c1-27(47)9-11-32(29(3)49)23-36(53)15-17-38(39(54)25-34(31(5)51)12-10-28(2)48)46-41(56)26-59-22-21-58-20-19-45-40(55)18-13-33(30(4)50)24-35(52)14-16-37(44)42(57)60-43(6,7)8/h32-34,37-38H,9-26,44H2,1-8H3,(H,45,55)(H,46,56) |
| InChIKey | KSHNKWJDXGWZGB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 265.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.03 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|