C17H25N5O5 — CID 165018071
N-[(3S)-6-[(1-amino-2-cyanoethylidene)amino]-1-(1,2-oxazol-3-yloxy)-2-oxohexan-3-yl]-2-methoxy-2-methylpropanamide (PubChem CID 165018071) has the molecular formula C17H25N5O5 and a molecular weight of 379.42 g/mol. Its IUPAC name is N-[(3S)-6-[(1-amino-2-cyanoethylidene)amino]-1-(1,2-oxazol-3-yloxy)-2-oxohexan-3-yl]-2-methoxy-2-methylpropanamide.
| Compound Name | N-[(3S)-6-[(1-amino-2-cyanoethylidene)amino]-1-(1,2-oxazol-3-yloxy)-2-oxohexan-3-yl]-2-methoxy-2-methylpropanamide |
|---|---|
| PubChem CID | 165018071 |
| Molecular Formula | C17H25N5O5 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-[(3S)-6-[(1-amino-2-cyanoethylidene)amino]-1-(1,2-oxazol-3-yloxy)-2-oxohexan-3-yl]-2-methoxy-2-methylpropanamide |
| SMILES | COC(C)(C)C(=O)N[C@@H](CCC/N=C(/N)CC#N)C(=O)COc1ccon1 |
| InChI | InChI=1S/C17H25N5O5/c1-17(2,25-3)16(24)21-12(5-4-9-20-14(19)6-8-18)13(23)11-26-15-7-10-27-22-15/h7,10,12H,4-6,9,11H2,1-3H3,(H2,19,20)(H,21,24)/t12-/m0/s1 |
| InChIKey | KSWFSXKLAIDAQS-LBPRGKRZSA-N |
| XLogP | 0.58 |
| TPSA | 152.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|