C23H23BN2O3 — CID 165018588
5-ethenyl-2-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-benzoxazole-7-carbonitrile (PubChem CID 165018588) has the molecular formula C23H23BN2O3 and a molecular weight of 386.26 g/mol. Its IUPAC name is 5-ethenyl-2-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-benzoxazole-7-carbonitrile.
| Compound Name | 5-ethenyl-2-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-benzoxazole-7-carbonitrile |
|---|---|
| PubChem CID | 165018588 |
| Molecular Formula | C23H23BN2O3 |
| Molecular Weight | 386.26 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 5-ethenyl-2-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-benzoxazole-7-carbonitrile |
| SMILES | C=Cc1cc(C#N)c2oc(-c3cccc(B4OC(C)(C)C(C)(C)O4)c3C)nc2c1 |
| InChI | InChI=1S/C23H23BN2O3/c1-7-15-11-16(13-25)20-19(12-15)26-21(27-20)17-9-8-10-18(14(17)2)24-28-22(3,4)23(5,6)29-24/h7-12H,1H2,2-6H3 |
| InChIKey | KURVNSXYOWSNAW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.26 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|