C20H32O4 — CID 165018733
benzyl 2,2-dimethylbutanoate;methyl 2,2-dimethylbutanoate (PubChem CID 165018733) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is benzyl 2,2-dimethylbutanoate;methyl 2,2-dimethylbutanoate.
| Compound Name | benzyl 2,2-dimethylbutanoate;methyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 165018733 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | benzyl 2,2-dimethylbutanoate;methyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC.CCC(C)(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H18O2.C7H14O2/c1-4-13(2,3)12(14)15-10-11-8-6-5-7-9-11;1-5-7(2,3)6(8)9-4/h5-9H,4,10H2,1-3H3;5H2,1-4H3 |
| InChIKey | KVEBOBQYIXJGEE-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |