C19H39NO3Si — CID 165018992
N-[4-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-6-hydroxy-2,3-dimethylcyclohexyl]acetamide (PubChem CID 165018992) has the molecular formula C19H39NO3Si and a molecular weight of 357.61 g/mol. Its IUPAC name is N-[4-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-6-hydroxy-2,3-dimethylcyclohexyl]acetamide.
| Compound Name | N-[4-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-6-hydroxy-2,3-dimethylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 165018992 |
| Molecular Formula | C19H39NO3Si |
| Molecular Weight | 357.61 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | N-[4-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-6-hydroxy-2,3-dimethylcyclohexyl]acetamide |
| SMILES | CC(=O)NC1C(O)CC(CO[Si](C)(C)C(C)(C)C(C)C)C(C)C1C |
| InChI | InChI=1S/C19H39NO3Si/c1-12(2)19(6,7)24(8,9)23-11-16-10-17(22)18(20-15(5)21)14(4)13(16)3/h12-14,16-18,22H,10-11H2,1-9H3,(H,20,21) |
| InChIKey | WWFBZBKMUALGAU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.61 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|