C34H22N4O5 — CID 165019667
9-(dimethylamino)-27-nitro-12-phenyl-5-oxa-1,12-diazaheptacyclo[15.11.1.02,15.04,13.06,11.021,29.023,28]nonacosa-2,4(13),6(11),7,9,14,17,19,21(29),23(28),24,26-dodecaene-16,22-dione (PubChem CID 165019667) has the molecular formula C34H22N4O5 and a molecular weight of 566.57 g/mol. Its IUPAC name is 9-(dimethylamino)-27-nitro-12-phenyl-5-oxa-1,12-diazaheptacyclo[15.11.1.02,15.04,13.06,11.021,29.023,28]nonacosa-2,4(13),6(11),7,9,14,17,19,21(29),23(28),24,26-dodecaene-16,22-dione.
| Compound Name | 9-(dimethylamino)-27-nitro-12-phenyl-5-oxa-1,12-diazaheptacyclo[15.11.1.02,15.04,13.06,11.021,29.023,28]nonacosa-2,4(13),6(11),7,9,14,17,19,21(29),23(28),24,26-dodecaene-16,22-dione |
|---|---|
| PubChem CID | 165019667 |
| Molecular Formula | C34H22N4O5 |
| Molecular Weight | 566.57 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | 9-(dimethylamino)-27-nitro-12-phenyl-5-oxa-1,12-diazaheptacyclo[15.11.1.02,15.04,13.06,11.021,29.023,28]nonacosa-2,4(13),6(11),7,9,14,17,19,21(29),23(28),24,26-dodecaene-16,22-dione |
| SMILES | CN(C)c1ccc2c(c1)N(c1ccccc1)c1cc3c(=O)c4cccc5c(=O)c6cccc([N+](=O)[O-])c6n(c3cc1O2)c45 |
| InChI | InChI=1S/C34H22N4O5/c1-35(2)20-14-15-29-27(16-20)36(19-8-4-3-5-9-19)28-17-24-26(18-30(28)43-29)37-31-21(10-6-11-22(31)34(24)40)33(39)23-12-7-13-25(32(23)37)38(41)42/h3-18H,1-2H3 |
| InChIKey | PDRCSUDYDJNRRF-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 97.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.57 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|