C81H52N4O2 — CID 165020345
9-[2-cyclohexa-2,4-dien-1-yl-4-[4,6-di(dibenzofuran-3-yl)-1,3,5-triazin-2-yl]-6-phenylphenyl]-1,3,6,8-tetraphenylcarbazole (PubChem CID 165020345) has the molecular formula C81H52N4O2 and a molecular weight of 1113.33 g/mol. Its IUPAC name is 9-[2-cyclohexa-2,4-dien-1-yl-4-[4,6-di(dibenzofuran-3-yl)-1,3,5-triazin-2-yl]-6-phenylphenyl]-1,3,6,8-tetraphenylcarbazole.
| Compound Name | 9-[2-cyclohexa-2,4-dien-1-yl-4-[4,6-di(dibenzofuran-3-yl)-1,3,5-triazin-2-yl]-6-phenylphenyl]-1,3,6,8-tetraphenylcarbazole |
|---|---|
| PubChem CID | 165020345 |
| Molecular Formula | C81H52N4O2 |
| Molecular Weight | 1113.33 g/mol |
| Exact Mass | 1112.41 |
| IUPAC Name | 9-[2-cyclohexa-2,4-dien-1-yl-4-[4,6-di(dibenzofuran-3-yl)-1,3,5-triazin-2-yl]-6-phenylphenyl]-1,3,6,8-tetraphenylcarbazole |
| SMILES | C1=CCC(c2cc(-c3nc(-c4ccc5c(c4)oc4ccccc45)nc(-c4ccc5c(c4)oc4ccccc45)n3)cc(-c3ccccc3)c2-n2c3c(-c4ccccc4)cc(-c4ccccc4)cc3c3cc(-c4ccccc4)cc(-c4ccccc4)c32)C=C1 |
| InChI | InChI=1S/C81H52N4O2/c1-7-23-51(24-8-1)59-43-66(53-27-11-3-12-28-53)77-70(45-59)71-46-60(52-25-9-2-10-26-52)44-67(54-29-13-4-14-30-54)78(71)85(77)76-68(55-31-15-5-16-32-55)47-61(48-69(76)56-33-17-6-18-34-56)81-83-79(57-39-41-64-62-35-19-21-37-72(62)86-74(64)49-57)82-80(84-81)58-40-42-65-63-36-20-22-38-73(63)87-75(65)50-58/h1-33,35-50,56H,34H2 |
| InChIKey | BGYVBPKVNNZXBE-UHFFFAOYSA-N |
| XLogP | 21.70 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 87 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1113.33 |
| LogP ≤ 5 | 21.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |