About ethyl 2-(2,2-difluoropropyl)pyrazole-3-carboxylate;ethyl 2-(2-oxopropyl)pyrazole-3-carboxylate
ethyl 2-(2,2-difluoropropyl)pyrazole-3-carboxylate;ethyl 2-(2-oxopropyl)pyrazole-3-carboxylate (PubChem CID 165020409) has the molecular formula C18H24F2N4O5
and a molecular weight of 414.41 g/mol. Its IUPAC name is ethyl 2-(2,2-difluoropropyl)pyrazole-3-carboxylate;ethyl 2-(2-oxopropyl)pyrazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-(2,2-difluoropropyl)pyrazole-3-carboxylate;ethyl 2-(2-oxopropyl)pyrazole-3-carboxylate |
| PubChem CID | 165020409 |
| Molecular Formula | C18H24F2N4O5 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | ethyl 2-(2,2-difluoropropyl)pyrazole-3-carboxylate;ethyl 2-(2-oxopropyl)pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1ccnn1CC(C)(F)F.CCOC(=O)c1ccnn1CC(C)=O |
| InChI | InChI=1S/C9H12F2N2O2.C9H12N2O3/c1-3-15-8(14)7-4-5-12-13(7)6-9(2,10)11;1-3-14-9(13)8-4-5-10-11(8)6-7(2)12/h4-5H,3,6H2,1-2H3;4-5H,3,6H2,1-2H3 |
| InChIKey | LBQBHKJMORRZNG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 105.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze ethyl 2-(2,2-difluoropropyl)pyrazole-3-carboxylate;ethyl 2-(2-oxopropyl)pyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(2,2-difluoropropyl)pyrazole-3-carboxylate;ethyl 2-(2-oxopropyl)pyrazole-3-carboxylate?
The IUPAC name of ethyl 2-(2,2-difluoropropyl)pyrazole-3-carboxylate;ethyl 2-(2-oxopropyl)pyrazole-3-carboxylate (CID 165020409) is ethyl 2-(2,2-difluoropropyl)pyrazole-3-carboxylate;ethyl 2-(2-oxopropyl)pyrazole-3-carboxylate.
What is the SMILES notation for ethyl 2-(2,2-difluoropropyl)pyrazole-3-carboxylate;ethyl 2-(2-oxopropyl)pyrazole-3-carboxylate?
The canonical SMILES for ethyl 2-(2,2-difluoropropyl)pyrazole-3-carboxylate;ethyl 2-(2-oxopropyl)pyrazole-3-carboxylate is CCOC(=O)c1ccnn1CC(C)(F)F.CCOC(=O)c1ccnn1CC(C)=O.
What is the InChIKey of ethyl 2-(2,2-difluoropropyl)pyrazole-3-carboxylate;ethyl 2-(2-oxopropyl)pyrazole-3-carboxylate?
The InChIKey is LBQBHKJMORRZNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F2N2O2.C9H12N2O3/c1-3-15-8(14)7-4-5-12-13(7)6-9(2,10)11;1-3-14-9(13)8-4-5-10-11(8)6-7(2)12/h4-5H,3,6H2,1-2H3;4-5H,3,6H2,1-2H3.
What are the key properties of ethyl 2-(2,2-difluoropropyl)pyrazole-3-carboxylate;ethyl 2-(2-oxopropyl)pyrazole-3-carboxylate?
ethyl 2-(2,2-difluoropropyl)pyrazole-3-carboxylate;ethyl 2-(2-oxopropyl)pyrazole-3-carboxylate has a molecular weight of 414.41 g/mol, XLogP of 2.36, 8 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2,2-difluoropropyl)pyrazole-3-carboxylate;ethyl 2-(2-oxopropyl)pyrazole-3-carboxylate is sourced from PubChem (CID 165020409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).